cas: 871366-38-0 — see every product listed under this CAS number, including other names
4-Methoxy-N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzylidene)aniline 98% (CAS 871366-38-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A163447-1g |
| cas | 871366-38-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 804.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A163447 |
N-(4-methoxyphenyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine (CAS 871366-38-0) is a chemical compound with the molecular formula C20H24BNO3 and a molecular weight of 337.2 g/mol. IUPAC name: N-(4-methoxyphenyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine. InChIKey: FEZZNCDZVGVBHZ-UHFFFAOYSA-N.
| Molecular formula | C20H24BNO3 |
|---|---|
| Molecular weight | 337.2 g/mol |
| IUPAC name | N-(4-methoxyphenyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine |
| InChIKey | FEZZNCDZVGVBHZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C=NC3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)