cas: 1371589-09-1 — see every product listed under this CAS number, including other names
4-Methoxycarbonyl-2-trifluoromethylphenylboronic acid pinacol ester, 96%, 96% (CAS 1371589-09-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HUSX-100mg |
| cas | 1371589-09-1 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 453.20 Pln | |
| Chemat | 250mg | 731.60 Pln | |
| Chemat | 1g | 1802.00 Pln | |
| Chemat | 5g | 6429.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)benzoate (CAS 1371589-09-1) is a chemical compound with the molecular formula C15H18BF3O4 and a molecular weight of 330.11 g/mol. IUPAC name: methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)benzoate. InChIKey: AYHRJMPGPKEQBG-UHFFFAOYSA-N.
| Molecular formula | C15H18BF3O4 |
|---|---|
| Molecular weight | 330.11 g/mol |
| IUPAC name | methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)benzoate |
| InChIKey | AYHRJMPGPKEQBG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(=O)OC)C(F)(F)F |
Computed by PubChem (NCBI)