cas: 14581-81-8 — see every product listed under this CAS number, including other names
4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside (CAS 14581-81-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM62910C-10g |
| cas | 14581-81-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1977.19 Pln | |
| Chemat | 25g | 3857.24 Pln | |
| Chemat | 50g | 6329.18 Pln | |
| Chemat | 5g | 1385.30 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate (CAS 14581-81-8) is a chemical compound with the molecular formula C21H26O11 and a molecular weight of 454.4 g/mol. IUPAC name: [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate. InChIKey: RPHXBVOPPUTUES-YMQHIKHWSA-N.
| Molecular formula | C21H26O11 |
|---|---|
| Molecular weight | 454.4 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate |
| InChIKey | RPHXBVOPPUTUES-YMQHIKHWSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC2=CC=C(C=C2)OC)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)