cas: 1492954-33-2 — see every product listed under this CAS number, including other names
4-Methyl-1-(tetrahydro-2h-pyran-2-yl)-1h-pyrazole-5-boronic acid pinacol ester, 95% (CAS 1492954-33-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | FM-3552-250mg |
| cas | 1492954-33-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 315.53 Pln | |
| Fluorochem | 1g | 857.01 Pln | |
| Fluorochem | 5g | 2658.46 Pln | |
| Fluorochem | 10g | 5251.29 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-methyl-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1492954-33-2) is a chemical compound with the molecular formula C15H25BN2O3 and a molecular weight of 292.18 g/mol. IUPAC name: 4-methyl-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: JUCGITVYAKQXHE-UHFFFAOYSA-N.
| Molecular formula | C15H25BN2O3 |
|---|---|
| Molecular weight | 292.18 g/mol |
| IUPAC name | 4-methyl-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | JUCGITVYAKQXHE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=NN2C3CCCCO3)C |
Computed by PubChem (NCBI)