cas: 87617-21-8 — see every product listed under this CAS number, including other names
4-Methyl-1-nitro-2-(trifluoromethyl)benzene 98% (CAS 87617-21-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A324673-1g |
| cas | 87617-21-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 520.56 Pln | |
| Ambeed | 25g | 2300.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A324673 |
4-methyl-1-nitro-2-(trifluoromethyl)benzene (CAS 87617-21-8) is a chemical compound with the molecular formula C8H6F3NO2 and a molecular weight of 205.13 g/mol. IUPAC name: 4-methyl-1-nitro-2-(trifluoromethyl)benzene. InChIKey: XEQAJBVCRSOQEY-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO2 |
|---|---|
| Molecular weight | 205.13 g/mol |
| IUPAC name | 4-methyl-1-nitro-2-(trifluoromethyl)benzene |
| InChIKey | XEQAJBVCRSOQEY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)