cas: 216955-61-2 — see every product listed under this CAS number, including other names
4-Methyl-2-[1-(tert-butoxycarbonyl)piperid-4-yl]-1,3-thiazole-5-carboxylic acid, 97% (CAS 216955-61-2) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC31101CB |
| cas | 216955-61-2 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 646.53 Pln | |
| Thermo Scientific | 1g | 1293.06 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
4-methyl-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1,3-thiazole-5-carboxylic acid (CAS 216955-61-2) is a chemical compound with the molecular formula C15H22N2O4S and a molecular weight of 326.4 g/mol. IUPAC name: 4-methyl-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1,3-thiazole-5-carboxylic acid. InChIKey: XDKKXEMKXSGKOR-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O4S |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 4-methyl-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1,3-thiazole-5-carboxylic acid |
| InChIKey | XDKKXEMKXSGKOR-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2CCN(CC2)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)