cas: 519054-54-7 — see every product listed under this CAS number, including other names
4-Methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-1,4-benzoxazine, 97% (CAS 519054-54-7) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC13539CB |
| cas | 519054-54-7 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 565.08 Pln | |
| Thermo Scientific | 1g | 1730.87 Pln | |
| Thermo Scientific | 5g | 4932.99 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1,4-benzoxazine (CAS 519054-54-7) is a chemical compound with the molecular formula C15H22BNO3 and a molecular weight of 275.15 g/mol. IUPAC name: 4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1,4-benzoxazine. InChIKey: QRAOZQGIUIDZQZ-UHFFFAOYSA-N.
| Molecular formula | C15H22BNO3 |
|---|---|
| Molecular weight | 275.15 g/mol |
| IUPAC name | 4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1,4-benzoxazine |
| InChIKey | QRAOZQGIUIDZQZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N(CCO3)C |
Computed by PubChem (NCBI)