cas: 910037-15-9 — see every product listed under this CAS number, including other names
4-Methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine, 90% (CAS 910037-15-9) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC62039CB |
| cas | 910037-15-9 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 789.07 Pln | |
| Thermo Scientific | 1g | 2066.86 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 90% |
4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyrido[3,2-b][1,4]oxazine (CAS 910037-15-9) is a chemical compound with the molecular formula C14H21BN2O3 and a molecular weight of 276.14 g/mol. IUPAC name: 4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyrido[3,2-b][1,4]oxazine. InChIKey: PDTRXHRSCGNYFD-UHFFFAOYSA-N.
| Molecular formula | C14H21BN2O3 |
|---|---|
| Molecular weight | 276.14 g/mol |
| IUPAC name | 4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyrido[3,2-b][1,4]oxazine |
| InChIKey | PDTRXHRSCGNYFD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N=C2)N(CCO3)C |
Computed by PubChem (NCBI)