cas: 796061-07-9 — see every product listed under this CAS number, including other names
4-Methyl-N-(2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)benzenesulfonamide, 97%(GC-MS),RG, 97%(GC-MS),RG (CAS 796061-07-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114F5A-250mg |
| cas | 796061-07-9 |
| size | 250mg |
| availability | 65g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 491.60 Pln | |
| Chemat | 5g | 1456.40 Pln |
| purity | 97%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
4-methyl-N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide (CAS 796061-07-9) is a chemical compound with the molecular formula C19H24BNO4S and a molecular weight of 373.3 g/mol. IUPAC name: 4-methyl-N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide. InChIKey: XJERZPFENBAXMZ-UHFFFAOYSA-N.
| Molecular formula | C19H24BNO4S |
|---|---|
| Molecular weight | 373.3 g/mol |
| IUPAC name | 4-methyl-N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide |
| InChIKey | XJERZPFENBAXMZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2NS(=O)(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)