cas: 957198-23-1 — see every product listed under this CAS number, including other names
4-Methyl-N-[4-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Phenyl]-1-Piperazineethanesulfonamide, 95%, 95% (CAS 957198-23-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EB51-100mg |
| cas | 957198-23-1 |
| size | 100mg |
| availability | 2.8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 1029.20 Pln | |
| Chemat | 1g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(4-methylpiperazin-1-yl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide (CAS 957198-23-1) is a chemical compound with the molecular formula C19H32BN3O4S and a molecular weight of 409.4 g/mol. IUPAC name: 2-(4-methylpiperazin-1-yl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide. InChIKey: CXLMKSSOLPDPKT-UHFFFAOYSA-N.
| Molecular formula | C19H32BN3O4S |
|---|---|
| Molecular weight | 409.4 g/mol |
| IUPAC name | 2-(4-methylpiperazin-1-yl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide |
| InChIKey | CXLMKSSOLPDPKT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NS(=O)(=O)CCN3CCN(CC3)C |
Computed by PubChem (NCBI)