cas: 28244-94-2 — see every product listed under this CAS number, including other names
4-Methylphenyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-glucopyranoside, 98%, 98% (CAS 28244-94-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g, 100g, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BE7Y-10g |
| cas | 28244-94-2 |
| size | 10g |
| availability | 161g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 410.00 Pln | |
| Chemat | 50g | 1235.60 Pln | |
| Chemat | 100g | 2109.20 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 237.20 Pln | |
| Chemat | 25g | 702.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl acetate (CAS 28244-94-2) is a chemical compound with the molecular formula C21H26O9S and a molecular weight of 454.5 g/mol. IUPAC name: [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl acetate. InChIKey: XRFOIRMXQHXTRL-ADAARDCZSA-N.
| Molecular formula | C21H26O9S |
|---|---|
| Molecular weight | 454.5 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl acetate |
| InChIKey | XRFOIRMXQHXTRL-ADAARDCZSA-N |
| SMILES | CC1=CC=C(C=C1)S[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)