cas: 28541-83-5 — see every product listed under this CAS number, including other names
4-Methylumbelliferyl alpha-D-Mannopyranoside, >97.0%(HPLC) (CAS 28541-83-5) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M3023-25MG |
| cas | 28541-83-5 |
| size | 25mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25mg | 246.19 Pln | |
| TCI | 100mg | 772.34 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(HPLC) |
4-methyl-7-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one (CAS 28541-83-5) is a chemical compound with the molecular formula C16H18O8 and a molecular weight of 338.31 g/mol. IUPAC name: 4-methyl-7-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one. InChIKey: YUDPTGPSBJVHCN-VMMWWAARSA-N.
| Molecular formula | C16H18O8 |
|---|---|
| Molecular weight | 338.31 g/mol |
| IUPAC name | 4-methyl-7-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
| InChIKey | YUDPTGPSBJVHCN-VMMWWAARSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)O[C@@H]3[C@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
Computed by PubChem (NCBI)