cas: 69414-26-2 — see every product listed under this CAS number, including other names
4-Methylumbelliferyl alpha-L-Arabinopyranoside, 98.0%, 98.0% (CAS 69414-26-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116MFT-50mg |
| cas | 69414-26-2 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 198.80 Pln | |
| Chemat | 250mg | 616.40 Pln | |
| Chemat | 1g | 2262.80 Pln |
| purity | 98.0% |
|---|---|
| delivery time | 3 weeks |
4-methyl-7-(3,4,5-trihydroxyoxan-2-yl)oxychromen-2-one (CAS 69414-26-2) is a chemical compound with the molecular formula C15H16O7 and a molecular weight of 308.28 g/mol. IUPAC name: 4-methyl-7-(3,4,5-trihydroxyoxan-2-yl)oxychromen-2-one. InChIKey: JWIYLOHVJDJZOQ-UHFFFAOYSA-N.
| Molecular formula | C15H16O7 |
|---|---|
| Molecular weight | 308.28 g/mol |
| IUPAC name | 4-methyl-7-(3,4,5-trihydroxyoxan-2-yl)oxychromen-2-one |
| InChIKey | JWIYLOHVJDJZOQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OC3C(C(C(CO3)O)O)O |
Computed by PubChem (NCBI)