cas: 885274-91-9 — see every product listed under this CAS number, including other names
4-N-BOC-AMINO-1-(PYRROLIDIN-3-YL) PIPERIDINE, 97% (CAS 885274-91-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F333832-250MG |
| cas | 885274-91-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1013.20 Pln | |
| Fluorochem | 500mg | 1539.06 Pln | |
| Fluorochem | 1g | 2294.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(1-pyrrolidin-3-ylpiperidin-4-yl)carbamate (CAS 885274-91-9) is a chemical compound with the molecular formula C14H27N3O2 and a molecular weight of 269.38 g/mol. IUPAC name: tert-butyl N-(1-pyrrolidin-3-ylpiperidin-4-yl)carbamate. InChIKey: RYEDWVUQVIEGNA-UHFFFAOYSA-N.
| Molecular formula | C14H27N3O2 |
|---|---|
| Molecular weight | 269.38 g/mol |
| IUPAC name | tert-butyl N-(1-pyrrolidin-3-ylpiperidin-4-yl)carbamate |
| InChIKey | RYEDWVUQVIEGNA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CC1)C2CCNC2 |
Computed by PubChem (NCBI)