cas: 28955-71-7 — see every product listed under this CAS number, including other names
4-Nitrobenzo[D]Oxazol-2(3H)-One, 98%, 98% (CAS 28955-71-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113UZK-100mg |
| cas | 28955-71-7 |
| size | 100mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 491.60 Pln | |
| Chemat | 5g | 1562.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-nitro-3H-1,3-benzoxazol-2-one (CAS 28955-71-7) is a chemical compound with the molecular formula C7H4N2O4 and a molecular weight of 180.12 g/mol. IUPAC name: 4-nitro-3H-1,3-benzoxazol-2-one. InChIKey: IXZMRVOOBBPFIZ-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O4 |
|---|---|
| Molecular weight | 180.12 g/mol |
| IUPAC name | 4-nitro-3H-1,3-benzoxazol-2-one |
| InChIKey | IXZMRVOOBBPFIZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(=O)N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)