4-Nitrobenzyl thiol, 98%
cas: 26798-33-4 — see every product listed under this CAS number, including other names
4-Nitrobenzyl thiol, 98% (CAS 26798-33-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A102569-100mg |
| cas | 26798-33-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 693.00 Pln | |
| Ambeed | 5g | 2072.50 Pln | |
| Ambeed | 10g | 2995.88 Pln | |
| Ambeed | 25g | 5042.88 Pln | |
| BLDpharm | 100mg | 208.84 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 741.99 Pln | |
| BLDpharm | 5g | 2224.80 Pln | |
| BLDpharm | 10g | 3224.44 Pln | |
| BLDpharm | 25g | 5434.78 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(4-nitrophenyl)methanethiol (CAS 26798-33-4) is a chemical compound with the molecular formula C7H7NO2S and a molecular weight of 169.20 g/mol. IUPAC name: (4-nitrophenyl)methanethiol. InChIKey: ACFHLWCEZHYYKX-UHFFFAOYSA-N.
| Molecular formula | C7H7NO2S |
|---|---|
| Molecular weight | 169.20 g/mol |
| IUPAC name | (4-nitrophenyl)methanethiol |
| InChIKey | ACFHLWCEZHYYKX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CS)[N+](=O)[O-] |
Computed by PubChem (NCBI)