CAS 84807-26-1 appears in our catalog under these names: 4-Nitro-2,3-dihydro-1h-indole, 95%, 4-Nitro-2,3-dihydro-1H-indole, 97%, 97%, 4-Nitroindoline, 97%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
4-nitro-2,3-dihydro-1H-indole (CAS 84807-26-1) is a chemical compound with the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. IUPAC name: 4-nitro-2,3-dihydro-1H-indole. InChIKey: VTQFDUKXUFJCAO-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 4-nitro-2,3-dihydro-1H-indole |
| InChIKey | VTQFDUKXUFJCAO-UHFFFAOYSA-N |
| SMILES | C1CNC2=C1C(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)