CAS 1610731-08-2 appears in our catalog under these names: 4-Nitrophenyl (3-(pyridin-2-yldisulfanyl)propyl) carbonate, 95%, 95%, 4-Nitrophenyl (3-(pyridin-2-yldisulfanyl)propyl) carbonate, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4-nitrophenyl) 3-(pyridin-2-yldisulfanyl)propyl carbonate (CAS 1610731-08-2) is a chemical compound with the molecular formula C15H14N2O5S2 and a molecular weight of 366.4 g/mol. IUPAC name: (4-nitrophenyl) 3-(pyridin-2-yldisulfanyl)propyl carbonate. InChIKey: IGLBKRUMVDUHRW-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O5S2 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | (4-nitrophenyl) 3-(pyridin-2-yldisulfanyl)propyl carbonate |
| InChIKey | IGLBKRUMVDUHRW-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)SSCCCOC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)