CAS 133860-61-4 is the registry number for 4-Nitrophenyl 3-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoate, 98%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
(4-nitrophenyl) 3-(2,5-dioxopyrrol-1-yl)propanoate (CAS 133860-61-4) is a chemical compound with the molecular formula C13H10N2O6 and a molecular weight of 290.23 g/mol. IUPAC name: (4-nitrophenyl) 3-(2,5-dioxopyrrol-1-yl)propanoate. InChIKey: GMOWQUYHVFFGHF-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O6 |
|---|---|
| Molecular weight | 290.23 g/mol |
| IUPAC name | (4-nitrophenyl) 3-(2,5-dioxopyrrol-1-yl)propanoate |
| InChIKey | GMOWQUYHVFFGHF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC(=O)CCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)