cas: 1262308-49-5 — see every product listed under this CAS number, including other names
4-Oxazolidinecarboxylic acid, 3-[2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]acetyl]-2,2,5-trimethyl-, (4S,5R)-, 95%, 95% (CAS 1262308-49-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110C1X-100mg |
| cas | 1262308-49-5 |
| size | 100mg |
| availability | 62.695g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 544.40 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1715.60 Pln | |
| Chemat | 50g | 3026.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(4S,5R)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid (CAS 1262308-49-5) is a chemical compound with the molecular formula C24H26N2O6 and a molecular weight of 438.5 g/mol. IUPAC name: (4S,5R)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid. InChIKey: NUXZZZZUNKUMGM-SZNDQCEHSA-N.
| Molecular formula | C24H26N2O6 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | (4S,5R)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid |
| InChIKey | NUXZZZZUNKUMGM-SZNDQCEHSA-N |
| SMILES | C[C@@H]1[C@H](N(C(O1)(C)C)C(=O)CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)