cas: 1623-92-3 — see every product listed under this CAS number, including other names
4-Phenoxybenzene-1-sulfonyl chloride 96% (CAS 1623-92-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A808569-250mg |
| cas | 1623-92-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1099.06 Pln | |
| Ambeed | 10g | 1883.38 Pln | |
| Ambeed | 25g | 3691.19 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A808569 |
4-phenoxybenzenesulfonyl chloride (CAS 1623-92-3) is a chemical compound with the molecular formula C12H9ClO3S and a molecular weight of 268.72 g/mol. IUPAC name: 4-phenoxybenzenesulfonyl chloride. InChIKey: QIZPONOMFWAPRR-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO3S |
|---|---|
| Molecular weight | 268.72 g/mol |
| IUPAC name | 4-phenoxybenzenesulfonyl chloride |
| InChIKey | QIZPONOMFWAPRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)