cas: 24476-55-9 — see every product listed under this CAS number, including other names
4-Phenyl-1-(p-tolylsulphonyl)piperidine-4-carbonitrile, 98%, 98% (CAS 24476-55-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113OA7-1g |
| cas | 24476-55-9 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 208.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(4-methylphenyl)sulfonyl-4-phenylpiperidine-4-carbonitrile (CAS 24476-55-9) is a chemical compound with the molecular formula C19H20N2O2S and a molecular weight of 340.4 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-4-phenylpiperidine-4-carbonitrile. InChIKey: RQTVIKMRXYJTDX-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O2S |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonyl-4-phenylpiperidine-4-carbonitrile |
| InChIKey | RQTVIKMRXYJTDX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC(CC2)(C#N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)