cas: 330793-45-8 — see every product listed under this CAS number, including other names
4-Phenylaminocarbonylphenylboronic acid, 98%, 98% (CAS 330793-45-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118HG2-250mg |
| cas | 330793-45-8 |
| size | 250mg |
| availability | 36.8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 635.60 Pln | |
| Chemat | 25g | 2637.20 Pln | |
| Chemat | 10g | 1149.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[4-(phenylcarbamoyl)phenyl]boronic acid (CAS 330793-45-8) is a chemical compound with the molecular formula C13H12BNO3 and a molecular weight of 241.05 g/mol. IUPAC name: [4-(phenylcarbamoyl)phenyl]boronic acid. InChIKey: DAUSGSRIYCUJDK-UHFFFAOYSA-N.
| Molecular formula | C13H12BNO3 |
|---|---|
| Molecular weight | 241.05 g/mol |
| IUPAC name | [4-(phenylcarbamoyl)phenyl]boronic acid |
| InChIKey | DAUSGSRIYCUJDK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)