cas: 22454-86-0 — see every product listed under this CAS number, including other names
4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, calcium salt(2:1), 95%, 95% (CAS 22454-86-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140YM-1g |
| cas | 22454-86-0 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 107.60 Pln | |
| Chemat | 100g | 242.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Calcium bis(2,4-dioxo-1H-pyrimidine-6-carboxylate) (CAS 22454-86-0) is a chemical compound with the molecular formula C10H6CaN4O8 and a molecular weight of 350.25 g/mol. IUPAC name: calcium bis(2,4-dioxo-1H-pyrimidine-6-carboxylate). InChIKey: SZKLQJZEAFLPDA-UHFFFAOYSA-L.
| Molecular formula | C10H6CaN4O8 |
|---|---|
| Molecular weight | 350.25 g/mol |
| IUPAC name | calcium bis(2,4-dioxo-1H-pyrimidine-6-carboxylate) |
| InChIKey | SZKLQJZEAFLPDA-UHFFFAOYSA-L |
| SMILES | C1=C(NC(=O)NC1=O)C(=O)[O-].C1=C(NC(=O)NC1=O)C(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)