cas: 4363-93-3 — see every product listed under this CAS number, including other names
4-Quinolinecarboxaldehyde, 95% (CAS 4363-93-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 100g. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 294820010 |
| cas | 4363-93-3 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 174.61 Pln | |
| Thermo Scientific (Acros) | 5g | 445.44 Pln | |
| Thermo Scientific (Acros) | 25g | 1955.50 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 190.58 Pln | |
| Fluorochem | 10g | 268.67 Pln | |
| Fluorochem | 25g | 591.48 Pln | |
| Fluorochem | 100g | 2200.28 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
Quinoline-4-carbaldehyde (CAS 4363-93-3) is a chemical compound with the molecular formula C10H7NO and a molecular weight of 157.17 g/mol. IUPAC name: quinoline-4-carbaldehyde. InChIKey: MGCGJBXTNWUHQE-UHFFFAOYSA-N.
| Molecular formula | C10H7NO |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | quinoline-4-carbaldehyde |
| InChIKey | MGCGJBXTNWUHQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)C=O |
Computed by PubChem (NCBI)