4-Sulfobenzoic acid potassium salt, 98%
cas: 5399-63-3 — see every product listed under this CAS number, including other names
4-Sulfobenzoic acid potassium salt, 98% (CAS 5399-63-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch114M1X-5g |
| cas | 5399-63-3 |
| size | 5g |
| availability | 500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 88.40 Pln | |
| Chemat | 25g | 160.40 Pln | |
| Chemat | 50g | 246.80 Pln | |
| Chemat | 100g | 414.80 Pln | |
| Chemat | 250g | 904.40 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 25g | 197.73 Pln | |
| BLDpharm | 100g | 503.18 Pln | |
| BLDpharm | 500g | 2224.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Potassium 4-carboxybenzenesulfonate (CAS 5399-63-3) is a chemical compound with the molecular formula C7H5KO5S and a molecular weight of 240.28 g/mol. IUPAC name: potassium 4-carboxybenzenesulfonate. InChIKey: PXRJBUPXKDXDLG-UHFFFAOYSA-M.
| Molecular formula | C7H5KO5S |
|---|---|
| Molecular weight | 240.28 g/mol |
| IUPAC name | potassium 4-carboxybenzenesulfonate |
| InChIKey | PXRJBUPXKDXDLG-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1C(=O)O)S(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)