cas: 256954-38-8 — see every product listed under this CAS number, including other names
4-Trifluoromethyl-5,6,7,8-tetrahydroquinazolin-2-ylamine, 98% (CAS 256954-38-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F020082-100MG |
| cas | 256954-38-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 482.14 Pln | |
| Fluorochem | 1g | 924.69 Pln | |
| Fluorochem | 5g | 2632.42 Pln | |
| Fluorochem | 10g | 4355.78 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-amine (CAS 256954-38-8) is a chemical compound with the molecular formula C9H10F3N3 and a molecular weight of 217.19 g/mol. IUPAC name: 4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-amine. InChIKey: DPGLGUYFUNFDRY-UHFFFAOYSA-N.
| Molecular formula | C9H10F3N3 |
|---|---|
| Molecular weight | 217.19 g/mol |
| IUPAC name | 4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-amine |
| InChIKey | DPGLGUYFUNFDRY-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NC(=N2)N)C(F)(F)F |
Computed by PubChem (NCBI)