cas: 1055995-87-3 — see every product listed under this CAS number, including other names
4-bromo-N,N-diethyl-2-fluorobenzenesulfonamide, 95%, 95% (CAS 1055995-87-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DTPT-100mg |
| cas | 1055995-87-3 |
| size | 100mg |
| availability | 0.91g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 957.20 Pln | |
| Chemat | 250mg | 1782.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-bromo-N,N-diethyl-2-fluorobenzenesulfonamide (CAS 1055995-87-3) is a chemical compound with the molecular formula C10H13BrFNO2S and a molecular weight of 310.19 g/mol. IUPAC name: 4-bromo-N,N-diethyl-2-fluorobenzenesulfonamide. InChIKey: JEFFMFZCMMUXTG-UHFFFAOYSA-N.
| Molecular formula | C10H13BrFNO2S |
|---|---|
| Molecular weight | 310.19 g/mol |
| IUPAC name | 4-bromo-N,N-diethyl-2-fluorobenzenesulfonamide |
| InChIKey | JEFFMFZCMMUXTG-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)