cas: 2246586-62-7 — see every product listed under this CAS number, including other names
4-chloro-N-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)benzamide, 95%, 95% (CAS 2246586-62-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FS9V-250mg |
| cas | 2246586-62-7 |
| size | 250mg |
| availability | 6.35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 5094.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-chloro-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide (CAS 2246586-62-7) is a chemical compound with the molecular formula C19H21BClNO3 and a molecular weight of 357.6 g/mol. IUPAC name: 4-chloro-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide. InChIKey: OSYYIIWUTXWWJE-UHFFFAOYSA-N.
| Molecular formula | C19H21BClNO3 |
|---|---|
| Molecular weight | 357.6 g/mol |
| IUPAC name | 4-chloro-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide |
| InChIKey | OSYYIIWUTXWWJE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)