CAS 56108-12-4 appears in our catalog under these names: 4–tert–Butylbenzamide, 4-tert-Butylbenzamide, 98% , 4-tert-Butylbenzamide 98%, 4-tert-Butylbenzamide, 98%, 98%, 4-(tert-Butyl)benzamide, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 10g, 25g, 5g, 50g, 1g, 500g.
4-tert-butylbenzamide (CAS 56108-12-4) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: 4-tert-butylbenzamide. InChIKey: VIPMBJSGYWWHAO-UHFFFAOYSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | 4-tert-butylbenzamide |
| InChIKey | VIPMBJSGYWWHAO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)N |
Computed by PubChem (NCBI)