5',5''''-(1,4-Phenylenebis(ethyne-2,1-diyl))bis(([1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid)), 98%
cas: 2476800-63-0 — see every product listed under this CAS number, including other names
5',5''''-(1,4-Phenylenebis(ethyne-2,1-diyl))bis(([1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid)), 98% (CAS 2476800-63-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1489842-100mg |
| cas | 2476800-63-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1388.31 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 547.61 Pln | |
| BLDpharm | 1g | 1491.72 Pln | |
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 1086.80 Pln | |
| Fluorochem | 100mg | 336.36 Pln | |
| Fluorochem | 250mg | 523.79 Pln | |
| Fluorochem | 1g | 1309.97 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4-[3-[2-[4-[2-[3,5-bis(4-carboxyphenyl)phenyl]ethynyl]phenyl]ethynyl]-5-(4-carboxyphenyl)phenyl]benzoic acid (CAS 2476800-63-0) is a chemical compound with the molecular formula C50H30O8 and a molecular weight of 758.8 g/mol. IUPAC name: 4-[3-[2-[4-[2-[3,5-bis(4-carboxyphenyl)phenyl]ethynyl]phenyl]ethynyl]-5-(4-carboxyphenyl)phenyl]benzoic acid. InChIKey: YWZGYYCKJXPWNJ-UHFFFAOYSA-N.
| Molecular formula | C50H30O8 |
|---|---|
| Molecular weight | 758.8 g/mol |
| IUPAC name | 4-[3-[2-[4-[2-[3,5-bis(4-carboxyphenyl)phenyl]ethynyl]phenyl]ethynyl]-5-(4-carboxyphenyl)phenyl]benzoic acid |
| InChIKey | YWZGYYCKJXPWNJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#CC2=CC(=CC(=C2)C3=CC=C(C=C3)C(=O)O)C4=CC=C(C=C4)C(=O)O)C#CC5=CC(=CC(=C5)C6=CC=C(C=C6)C(=O)O)C7=CC=C(C=C7)C(=O)O |
Computed by PubChem (NCBI)