5',5''''-(Anthracene-9,10-diylbis(ethyne-2,1-diyl))bis(([1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid)), 95%
cas: 2971723-83-6 — see every product listed under this CAS number, including other names
5',5''''-(Anthracene-9,10-diylbis(ethyne-2,1-diyl))bis(([1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid)), 95% (CAS 2971723-83-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2423667-100mg |
| cas | 2971723-83-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 871.00 Pln | |
| Ambeed | 1g | 2211.56 Pln | |
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 510.80 Pln | |
| Chemat | 1g | 1739.60 Pln | |
| BLDpharm | 100mg | 553.16 Pln | |
| BLDpharm | 250mg | 858.61 Pln | |
| BLDpharm | 1g | 2169.26 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-[3-[2-[10-[2-[3,5-bis(4-carboxyphenyl)phenyl]ethynyl]anthracen-9-yl]ethynyl]-5-(4-carboxyphenyl)phenyl]benzoic acid (CAS 2971723-83-6) is a chemical compound with the molecular formula C58H34O8 and a molecular weight of 858.9 g/mol. IUPAC name: 4-[3-[2-[10-[2-[3,5-bis(4-carboxyphenyl)phenyl]ethynyl]anthracen-9-yl]ethynyl]-5-(4-carboxyphenyl)phenyl]benzoic acid. InChIKey: ATJRNMYJUSCNPL-UHFFFAOYSA-N.
| Molecular formula | C58H34O8 |
|---|---|
| Molecular weight | 858.9 g/mol |
| IUPAC name | 4-[3-[2-[10-[2-[3,5-bis(4-carboxyphenyl)phenyl]ethynyl]anthracen-9-yl]ethynyl]-5-(4-carboxyphenyl)phenyl]benzoic acid |
| InChIKey | ATJRNMYJUSCNPL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2C#CC4=CC(=CC(=C4)C5=CC=C(C=C5)C(=O)O)C6=CC=C(C=C6)C(=O)O)C#CC7=CC(=CC(=C7)C8=CC=C(C=C8)C(=O)O)C9=CC=C(C=C9)C(=O)O |
Computed by PubChem (NCBI)