5'-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,1':3',1''-terphenyl]-4,4''-diamine, 98%
cas: 2754262-59-2 — see every product listed under this CAS number, including other names
5'-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,1':3',1''-terphenyl]-4,4''-diamine, 98% (CAS 2754262-59-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1941009-250mg |
| cas | 2754262-59-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 965.56 Pln | |
| Ambeed | 1g | 2495.25 Pln | |
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 938.00 Pln | |
| Chemat | 1g | 2176.40 Pln | |
| BLDpharm | 100mg | 647.57 Pln | |
| BLDpharm | 250mg | 1036.33 Pln | |
| BLDpharm | 1g | 2685.75 Pln | |
| Fluorochem | 100mg | 622.72 Pln | |
| Fluorochem | 250mg | 992.38 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4-[3-(4-aminophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]aniline (CAS 2754262-59-2) is a chemical compound with the molecular formula C24H27BN2O2 and a molecular weight of 386.3 g/mol. IUPAC name: 4-[3-(4-aminophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]aniline. InChIKey: DYUZGZVJTFGXPE-UHFFFAOYSA-N.
| Molecular formula | C24H27BN2O2 |
|---|---|
| Molecular weight | 386.3 g/mol |
| IUPAC name | 4-[3-(4-aminophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]aniline |
| InChIKey | DYUZGZVJTFGXPE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)C3=CC=C(C=C3)N)C4=CC=C(C=C4)N |
Computed by PubChem (NCBI)