5'-(4-Amino-3,5-difluorophenyl)-3,3'',5,5''-tetrafluoro-[1,1':3',1''-terphenyl]-4,4''-diamine, 95%
cas: 2750241-87-1 — see every product listed under this CAS number, including other names
5'-(4-Amino-3,5-difluorophenyl)-3,3'',5,5''-tetrafluoro-[1,1':3',1''-terphenyl]-4,4''-diamine, 95% (CAS 2750241-87-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1680562-100mg |
| cas | 2750241-87-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 887.69 Pln | |
| Ambeed | 250mg | 1438.38 Pln | |
| Ambeed | 1g | 3763.50 Pln | |
| BLDpharm | 100mg | 869.72 Pln | |
| BLDpharm | 250mg | 1408.42 Pln | |
| BLDpharm | 1g | 3690.95 Pln | |
| Chemat | 100mg | 702.80 Pln | |
| Chemat | 250mg | 1149.20 Pln | |
| Chemat | 1g | 2992.40 Pln | |
| Fluorochem | 100mg | 851.80 Pln | |
| Fluorochem | 250mg | 1382.86 Pln | |
| Fluorochem | 1g | 3522.74 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-[3,5-bis(4-amino-3,5-difluorophenyl)phenyl]-2,6-difluoroaniline (CAS 2750241-87-1) is a chemical compound with the molecular formula C24H15F6N3 and a molecular weight of 459.4 g/mol. IUPAC name: 4-[3,5-bis(4-amino-3,5-difluorophenyl)phenyl]-2,6-difluoroaniline. InChIKey: KGGDTRCQYRHSIP-UHFFFAOYSA-N.
| Molecular formula | C24H15F6N3 |
|---|---|
| Molecular weight | 459.4 g/mol |
| IUPAC name | 4-[3,5-bis(4-amino-3,5-difluorophenyl)phenyl]-2,6-difluoroaniline |
| InChIKey | KGGDTRCQYRHSIP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C2=CC(=C(C(=C2)F)N)F)C3=CC(=C(C(=C3)F)N)F)C4=CC(=C(C(=C4)F)N)F |
Computed by PubChem (NCBI)