cas: 376592-58-4 — see every product listed under this CAS number, including other names
5'-Chloro-2'-hydroxy-3'-nitro-[1,1'-biphenyl]-3-carboxylic acid, 95% (CAS 376592-58-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F226761-250MG |
| cas | 376592-58-4 |
| size | 250mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 404.04 Pln | |
| Fluorochem | 5g | 1289.15 Pln | |
| Fluorochem | 10g | 2111.77 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 270.25 Pln | |
| Ambeed | 5g | 704.12 Pln | |
| Ambeed | 10g | 1182.50 Pln | |
| Ambeed | 25g | 2105.88 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
3-(5-chloro-2-hydroxy-3-nitrophenyl)benzoic acid (CAS 376592-58-4) is a chemical compound with the molecular formula C13H8ClNO5 and a molecular weight of 293.66 g/mol. IUPAC name: 3-(5-chloro-2-hydroxy-3-nitrophenyl)benzoic acid. InChIKey: PGNTVCRTPYDGRN-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNO5 |
|---|---|
| Molecular weight | 293.66 g/mol |
| IUPAC name | 3-(5-chloro-2-hydroxy-3-nitrophenyl)benzoic acid |
| InChIKey | PGNTVCRTPYDGRN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=C(C(=CC(=C2)Cl)[N+](=O)[O-])O |
Computed by PubChem (NCBI)