cas: 144089-96-3 — see every product listed under this CAS number, including other names
5'-DMT-2'-F-ibu-dG, 98%, 98% (CAS 144089-96-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112IWL-100mg |
| cas | 144089-96-3 |
| size | 100mg |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 500mg | 184.40 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1442.00 Pln | |
| Chemat | 50g | 2334.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-[9-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluoro-4-hydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide (CAS 144089-96-3) is a chemical compound with the molecular formula C35H36FN5O7 and a molecular weight of 657.7 g/mol. IUPAC name: N-[9-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluoro-4-hydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide. InChIKey: QQQXVSXVBFQISZ-UNVYQVKTSA-N.
| Molecular formula | C35H36FN5O7 |
|---|---|
| Molecular weight | 657.7 g/mol |
| IUPAC name | N-[9-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluoro-4-hydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
| InChIKey | QQQXVSXVBFQISZ-UNVYQVKTSA-N |
| SMILES | CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O)F |
Computed by PubChem (NCBI)