CAS 769965-95-9 appears in our catalog under these names: 5'-Fluorospiro[cyclopropane-1,3'-indolin]-2'-one, 95%, 5'-Fluorospiro[cyclopropane-1,3'-indolin]-2'-one, 98%, 98%, 5'-FLUOROSPIRO[CYCLOPROPANE-1,3'-INDOLIN]-2'-ONE, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
5-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one (CAS 769965-95-9) is a chemical compound with the molecular formula C10H8FNO and a molecular weight of 177.17 g/mol. IUPAC name: 5-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one. InChIKey: KTOQUUHQTKCDEM-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO |
|---|---|
| Molecular weight | 177.17 g/mol |
| IUPAC name | 5-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one |
| InChIKey | KTOQUUHQTKCDEM-UHFFFAOYSA-N |
| SMILES | C1CC12C3=C(C=CC(=C3)F)NC2=O |
Computed by PubChem (NCBI)