cas: 146954-74-7 — see every product listed under this CAS number, including other names
5'-O-[Bis(4-methoxyphenyl)phenylmethyl]-2'-deoxy-2'-fluorouridine, 96%, 96% (CAS 146954-74-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112EHF-100mg |
| cas | 146954-74-7 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 510.80 Pln | |
| Chemat | 25g | 890.00 Pln | |
| Chemat | 50g | 1442.00 Pln | |
| Chemat | 100g | 1994.00 Pln | |
| Chemat | 1mg | 78.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione (CAS 146954-74-7) is a chemical compound with the molecular formula C30H29FN2O7 and a molecular weight of 548.6 g/mol. IUPAC name: 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione. InChIKey: CSSFZSSZXOCCJB-YULOIDQLSA-N.
| Molecular formula | C30H29FN2O7 |
|---|---|
| Molecular weight | 548.6 g/mol |
| IUPAC name | 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | CSSFZSSZXOCCJB-YULOIDQLSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OC[C@@H]4[C@H]([C@H]([C@@H](O4)N5C=CC(=O)NC5=O)F)O |
Computed by PubChem (NCBI)