cas: 40615-39-2 — see every product listed under this CAS number, including other names
5'-O-Dimethoxytrityl-deoxythymidine 95% (CAS 40615-39-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A137489-1g |
| cas | 40615-39-2 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 142.31 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 264.69 Pln | |
| Ambeed | 25g | 420.44 Pln | |
| Ambeed | 100g | 1193.62 Pln | |
| Ambeed | 500g | 5137.44 Pln | |
| Ambeed | 1000g | 8185.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A137489 |
1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 40615-39-2) is a chemical compound with the molecular formula C31H32N2O7 and a molecular weight of 544.6 g/mol. IUPAC name: 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: UBTJZUKVKGZHAD-UPRLRBBYSA-N.
| Molecular formula | C31H32N2O7 |
|---|---|
| Molecular weight | 544.6 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | UBTJZUKVKGZHAD-UPRLRBBYSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O |
Computed by PubChem (NCBI)