CAS 14172-91-9 appears in our catalog under these names: 5,10,15,20–Tetraphenyl–21H,23H–porphine copper(II), Copper(II) Tetraphenylporphyrin, >85.0%(HPLC)(T), (5,10,15,20-Tetraphenyl-21H,23H-porphinato)copper, 98%, 98%, 5,10,15,20-Tetraphenyl-21H,23H-porphine copper(II), 95%, 5,10,15,20-Tetraphenyl-21H,23H-porphine copper(II), 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g.
Copper 5,10,15,20-tetraphenylporphyrin-22,24-diide (CAS 14172-91-9) is a chemical compound with the molecular formula C44H28CuN4 and a molecular weight of 676.3 g/mol. IUPAC name: copper 5,10,15,20-tetraphenylporphyrin-22,24-diide. InChIKey: RKTYLMNFRDHKIL-UHFFFAOYSA-N.
| Molecular formula | C44H28CuN4 |
|---|---|
| Molecular weight | 676.3 g/mol |
| IUPAC name | copper 5,10,15,20-tetraphenylporphyrin-22,24-diide |
| InChIKey | RKTYLMNFRDHKIL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C=C4)C9=CC=CC=C9)[N-]3.[Cu+2] |
Computed by PubChem (NCBI)