5,12-Dibromoanthra[2,1,9-def:6,5,10-d'e'f']diisochromene-1,3,8,10-tetraone, 95%
cas: 118129-60-5 — see every product listed under this CAS number, including other names
5,12-Dibromoanthra[2,1,9-def:6,5,10-d'e'f']diisochromene-1,3,8,10-tetraone, 95% (CAS 118129-60-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F552311-100MG |
| cas | 118129-60-5 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 117.68 Pln | |
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 424.87 Pln | |
| Fluorochem | 10g | 768.50 Pln | |
| Fluorochem | 25g | 1455.76 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 458.75 Pln | |
| BLDpharm | 25g | 1536.15 Pln | |
| BLDpharm | 100g | 4768.35 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
11,22-dibromo-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone (CAS 118129-60-5) is a chemical compound with the molecular formula C24H6Br2O6 and a molecular weight of 550.1 g/mol. IUPAC name: 11,22-dibromo-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone. InChIKey: WPBVUAVIGWNDGT-UHFFFAOYSA-N.
| Molecular formula | C24H6Br2O6 |
|---|---|
| Molecular weight | 550.1 g/mol |
| IUPAC name | 11,22-dibromo-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone |
| InChIKey | WPBVUAVIGWNDGT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=CC(=C4C3=C1C5=C(C=C6C7=C(C=CC4=C57)C(=O)OC6=O)Br)Br)C(=O)OC2=O |
Computed by PubChem (NCBI)