CAS 2378344-74-0 appears in our catalog under these names: 5,5'-(Phenylphosphanediyl)bis(2-(trifluoromethyl)pyridine), 95%, 95%, 5,5'-(Phenylphosphanediyl)bis(2-(trifluoromethyl)pyridine), 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Phenyl-bis[6-(trifluoromethyl)-3-pyridinyl]phosphane (CAS 2378344-74-0) is a chemical compound with the molecular formula C18H11F6N2P and a molecular weight of 400.3 g/mol. IUPAC name: phenyl-bis[6-(trifluoromethyl)-3-pyridinyl]phosphane. InChIKey: FWZOAHGYZJRZAA-UHFFFAOYSA-N.
| Molecular formula | C18H11F6N2P |
|---|---|
| Molecular weight | 400.3 g/mol |
| IUPAC name | phenyl-bis[6-(trifluoromethyl)-3-pyridinyl]phosphane |
| InChIKey | FWZOAHGYZJRZAA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CN=C(C=C2)C(F)(F)F)C3=CN=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)