CAS 2540-99-0 appears in our catalog under these names: 5,5'-Sulfonylbis(isobenzofuran-1,3-dione), ≥99%(HPLC), 3,3',4,4'–Diphenylsulfonetetracarboxylic dianhydride, 5,5'-Sulfonylbis(isobenzofuran-1,3-dione), >99.0%(HPLC)(T), 5,5'-Sulfonylbis(isobenzofuran-1,3-dione), 98%, 98%. Offered by: Fluorochem, GLPBio, TCI, Chemat. Available pack sizes: 1g, 250mg, 5g, 25g, 100g, 500g.
5-[(1,3-dioxo-2-benzofuran-5-yl)sulfonyl]-2-benzofuran-1,3-dione (CAS 2540-99-0) is a chemical compound with the molecular formula C16H6O8S and a molecular weight of 358.3 g/mol. IUPAC name: 5-[(1,3-dioxo-2-benzofuran-5-yl)sulfonyl]-2-benzofuran-1,3-dione. InChIKey: ZHBXLZQQVCDGPA-UHFFFAOYSA-N.
| Molecular formula | C16H6O8S |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 5-[(1,3-dioxo-2-benzofuran-5-yl)sulfonyl]-2-benzofuran-1,3-dione |
| InChIKey | ZHBXLZQQVCDGPA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)C3=CC4=C(C=C3)C(=O)OC4=O)C(=O)OC2=O |
Computed by PubChem (NCBI)