CAS 132392-26-8 is the registry number for 5,5,8,8-Tetramethyl-5,6,7,8-tetrahydro-2-naphthalenesulfonyl chloride, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-sulfonyl chloride (CAS 132392-26-8) is a chemical compound with the molecular formula C14H19ClO2S and a molecular weight of 286.8 g/mol. IUPAC name: 5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-sulfonyl chloride. InChIKey: BEAYCJSJSMOLFG-UHFFFAOYSA-N.
| Molecular formula | C14H19ClO2S |
|---|---|
| Molecular weight | 286.8 g/mol |
| IUPAC name | 5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-sulfonyl chloride |
| InChIKey | BEAYCJSJSMOLFG-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=CC(=C2)S(=O)(=O)Cl)(C)C)C |
Computed by PubChem (NCBI)