Products 132392-26-8

CAS 132392-26-8 is the registry number for 5,5,8,8-Tetramethyl-5,6,7,8-tetrahydro-2-naphthalenesulfonyl chloride, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.

Structural formula: {0} (CAS {1})

5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-sulfonyl chloride (CAS 132392-26-8) is a chemical compound with the molecular formula C14H19ClO2S and a molecular weight of 286.8 g/mol. IUPAC name: 5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-sulfonyl chloride. InChIKey: BEAYCJSJSMOLFG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19ClO2S
Molecular weight286.8 g/mol
IUPAC name5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-sulfonyl chloride
InChIKeyBEAYCJSJSMOLFG-UHFFFAOYSA-N
SMILESCC1(CCC(C2=C1C=CC(=C2)S(=O)(=O)Cl)(C)C)C

Computed by PubChem (NCBI)