cas: 42013-48-9 — see every product listed under this CAS number, including other names
5,5-Dimethyl-2-phenylmorpholine, 98%, 98% (CAS 42013-48-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CVDM-1g |
| cas | 42013-48-9 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 357.20 Pln | |
| Chemat | 5g | 1283.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5,5-dimethyl-2-phenylmorpholine (CAS 42013-48-9) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. IUPAC name: 5,5-dimethyl-2-phenylmorpholine. InChIKey: KJUOROGOOZJYAI-UHFFFAOYSA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | 5,5-dimethyl-2-phenylmorpholine |
| InChIKey | KJUOROGOOZJYAI-UHFFFAOYSA-N |
| SMILES | CC1(COC(CN1)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)