cas: 497959-45-2 — see every product listed under this CAS number, including other names
5,5-Dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-enone, 95%, 95% (CAS 497959-45-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DDM3-50mg |
| cas | 497959-45-2 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 275.60 Pln | |
| Chemat | 100mg | 381.20 Pln | |
| Chemat | 250mg | 506.00 Pln | |
| Chemat | 1g | 971.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-one (CAS 497959-45-2) is a chemical compound with the molecular formula C14H23BO3 and a molecular weight of 250.14 g/mol. IUPAC name: 5,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-one. InChIKey: CHCPOPVEQVWOHT-UHFFFAOYSA-N.
| Molecular formula | C14H23BO3 |
|---|---|
| Molecular weight | 250.14 g/mol |
| IUPAC name | 5,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-one |
| InChIKey | CHCPOPVEQVWOHT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=O)CC(C2)(C)C |
Computed by PubChem (NCBI)