cas: 517-51-1 — see every product listed under this CAS number, including other names
5,6,11,12-Tetraphenyltetracene, 98% (CAS 517-51-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I09S-1g |
| cas | 517-51-1 |
| size | 1g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 275.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5,6,11,12-tetraphenyltetracene (CAS 517-51-1) is a chemical compound with the molecular formula C42H28 and a molecular weight of 532.7 g/mol. IUPAC name: 5,6,11,12-tetraphenyltetracene. InChIKey: YYMBJDOZVAITBP-UHFFFAOYSA-N.
| Molecular formula | C42H28 |
|---|---|
| Molecular weight | 532.7 g/mol |
| IUPAC name | 5,6,11,12-tetraphenyltetracene |
| InChIKey | YYMBJDOZVAITBP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC=CC3=C(C4=C(C5=CC=CC=C5C(=C24)C6=CC=CC=C6)C7=CC=CC=C7)C8=CC=CC=C8 |
Computed by PubChem (NCBI)