cas: 1820703-96-5 — see every product listed under this CAS number, including other names
5,6,7,8-Tetrahydro-pyrido(3,4-d)pyrimidin-2-ylamine dihydrochloride, 95+% (CAS 1820703-96-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A999402-5g |
| cas | 1820703-96-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 25712.89 Pln | |
| AmBeed | 10g | 38068.87 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine;dihydrochloride (CAS 1820703-96-5) is a chemical compound with the molecular formula C7H12Cl2N4 and a molecular weight of 223.10 g/mol. IUPAC name: 5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine;dihydrochloride. InChIKey: ASALWYKERCYNIS-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N4 |
|---|---|
| Molecular weight | 223.10 g/mol |
| IUPAC name | 5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine;dihydrochloride |
| InChIKey | ASALWYKERCYNIS-UHFFFAOYSA-N |
| SMILES | C1CNCC2=NC(=NC=C21)N.Cl.Cl |
Computed by PubChem (NCBI)