cas: 5626-99-3 — see every product listed under this CAS number, including other names
5,6–Dihydrodeoxyuridine (CAS 5626-99-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 5mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD11261-100mg |
| cas | 5626-99-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 5310.30 Pln | |
| GLPBio | 10mg | 1444.21 Pln | |
| GLPBio | 25mg | 2277.34 Pln | |
| GLPBio | 50mg | 3307.05 Pln | |
| GLPBio | 5mg | 994.88 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2,4-dione (CAS 5626-99-3) is a chemical compound with the molecular formula C9H14N2O5 and a molecular weight of 230.22 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2,4-dione. InChIKey: XMJRLEURHMTTRX-SHYZEUOFSA-N.
| Molecular formula | C9H14N2O5 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2,4-dione |
| InChIKey | XMJRLEURHMTTRX-SHYZEUOFSA-N |
| SMILES | C1CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)