5,6-Diaminopyrimidin-4(3H)-one sulfate(2:1) 95%
cas: 102783-18-6 — see every product listed under this CAS number, including other names
5,6-Diaminopyrimidin-4(3H)-one sulfate(2:1) 95% (CAS 102783-18-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A171243-1g |
| cas | 102783-18-6 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 236.88 Pln | |
| Ambeed | 5g | 609.56 Pln | |
| Ambeed | 25g | 1816.62 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A171243 |
Bis(4,5-diamino-1H-pyrimidin-6-one);sulfuric acid (CAS 102783-18-6) is a chemical compound with the molecular formula C8H14N8O6S and a molecular weight of 350.32 g/mol. IUPAC name: bis(4,5-diamino-1H-pyrimidin-6-one);sulfuric acid. InChIKey: SVJZVGHPJPXEJQ-UHFFFAOYSA-N.
| Molecular formula | C8H14N8O6S |
|---|---|
| Molecular weight | 350.32 g/mol |
| IUPAC name | bis(4,5-diamino-1H-pyrimidin-6-one);sulfuric acid |
| InChIKey | SVJZVGHPJPXEJQ-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(C(=O)N1)N)N.C1=NC(=C(C(=O)N1)N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Sulfuric acid--5,6-diaminopyrimidin-4(1H)-one (1/2), 4,5-Diamino-6-hydroxypyrimidine hemisulfate salt, 5,6-diamino-1H-pyrimidin-4-one;sulfuric acid, bis(5,6-diaminopyrimidin-4-ol); sulfuric acid, SVJZVGHPJPXEJQ-UHFFFAOYSA-N, 4,5-Diamino-6-hydroxypyrimidine hemisulphate, 5,6-Diaminopyrimidin-4(1H)-one Hemisulfate, 5,6-diaminopyrimidin-4(3H)-one hemisulfate